C20H17ClN4O3 — CID 1302970
1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-phenoxypurine-2,6-dione (PubChem CID 1302970) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-phenoxypurine-2,6-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-phenoxypurine-2,6-dione |
|---|---|
| PubChem CID | 1302970 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-phenoxypurine-2,6-dione |
| SMILES | Cn1c(Oc2ccccc2)nc2c1c(=O)n(Cc1ccc(Cl)cc1)c(=O)n2C |
| InChI | InChI=1S/C20H17ClN4O3/c1-23-16-17(22-19(23)28-15-6-4-3-5-7-15)24(2)20(27)25(18(16)26)12-13-8-10-14(21)11-9-13/h3-11H,12H2,1-2H3 |
| InChIKey | OEOIKDGNIRWYHS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |