C24H25N5O3 — CID 1307880
1,7-dibenzyl-3-methyl-8-morpholin-4-ylpurine-2,6-dione (PubChem CID 1307880) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 1,7-dibenzyl-3-methyl-8-morpholin-4-ylpurine-2,6-dione.
| Compound Name | 1,7-dibenzyl-3-methyl-8-morpholin-4-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 1307880 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1,7-dibenzyl-3-methyl-8-morpholin-4-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2)c(=O)c2c1nc(N1CCOCC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H25N5O3/c1-26-21-20(22(30)29(24(26)31)17-19-10-6-3-7-11-19)28(16-18-8-4-2-5-9-18)23(25-21)27-12-14-32-15-13-27/h2-11H,12-17H2,1H3 |
| InChIKey | YZFTZYLLSFYPLG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |