C20H25N5O3 — CID 30842870
1-benzyl-3-methyl-8-morpholin-4-yl-7-propan-2-ylpurine-2,6-dione (PubChem CID 30842870) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-benzyl-3-methyl-8-morpholin-4-yl-7-propan-2-ylpurine-2,6-dione.
| Compound Name | 1-benzyl-3-methyl-8-morpholin-4-yl-7-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 30842870 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-benzyl-3-methyl-8-morpholin-4-yl-7-propan-2-ylpurine-2,6-dione |
| SMILES | CC(C)n1c(N2CCOCC2)nc2c1c(=O)n(Cc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C20H25N5O3/c1-14(2)25-16-17(21-19(25)23-9-11-28-12-10-23)22(3)20(27)24(18(16)26)13-15-7-5-4-6-8-15/h4-8,14H,9-13H2,1-3H3 |
| InChIKey | VPRMMQNLEIMUSH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |