C18H21N5O3 — CID 979191
7-benzyl-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione (PubChem CID 979191) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione.
| Compound Name | 7-benzyl-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 979191 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCOCC3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C18H21N5O3/c1-20-15-14(16(24)21(2)18(20)25)23(12-13-6-4-3-5-7-13)17(19-15)22-8-10-26-11-9-22/h3-7H,8-12H2,1-2H3 |
| InChIKey | UCNPEYHYXBMSRJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |