C14H19N5O4 — CID 6933227
1,3-dimethyl-8-morpholin-4-yl-7-[[(2S)-oxiran-2-yl]methyl]purine-2,6-dione (PubChem CID 6933227) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1,3-dimethyl-8-morpholin-4-yl-7-[[(2S)-oxiran-2-yl]methyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-morpholin-4-yl-7-[[(2S)-oxiran-2-yl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 6933227 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1,3-dimethyl-8-morpholin-4-yl-7-[[(2S)-oxiran-2-yl]methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCOCC3)n2C[C@H]2CO2)n(C)c1=O |
| InChI | InChI=1S/C14H19N5O4/c1-16-11-10(12(20)17(2)14(16)21)19(7-9-8-23-9)13(15-11)18-3-5-22-6-4-18/h9H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | ATURGUAKMMAQKR-VIFPVBQESA-N |
| XLogP | -1.33 |
| TPSA | 86.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|