C15H24N6O2 — CID 20846594
7-(3-aminopropyl)-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 20846594) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 7-(3-aminopropyl)-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-(3-aminopropyl)-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 20846594 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 7-(3-aminopropyl)-1,3-dimethyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCCCC3)n2CCCN)n(C)c1=O |
| InChI | InChI=1S/C15H24N6O2/c1-18-12-11(13(22)19(2)15(18)23)21(10-6-7-16)14(17-12)20-8-4-3-5-9-20/h3-10,16H2,1-2H3 |
| InChIKey | MNZUROAQBFMEDT-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |