C15H22N6O3 — CID 16805311
2-[8-(azepan-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide (PubChem CID 16805311) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[8-(azepan-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide.
| Compound Name | 2-[8-(azepan-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide |
|---|---|
| PubChem CID | 16805311 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[8-(azepan-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide |
| SMILES | Cn1c(=O)c2c(nc(N3CCCCCC3)n2CC(N)=O)n(C)c1=O |
| InChI | InChI=1S/C15H22N6O3/c1-18-12-11(13(23)19(2)15(18)24)21(9-10(16)22)14(17-12)20-7-5-3-4-6-8-20/h3-9H2,1-2H3,(H2,16,22) |
| InChIKey | WCUWLNKRKBXLJB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |