C17H25N5O3 — CID 3137578
8-(azepan-1-yl)-1,3-dimethyl-7-(3-oxobutan-2-yl)purine-2,6-dione (PubChem CID 3137578) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 8-(azepan-1-yl)-1,3-dimethyl-7-(3-oxobutan-2-yl)purine-2,6-dione.
| Compound Name | 8-(azepan-1-yl)-1,3-dimethyl-7-(3-oxobutan-2-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 3137578 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 8-(azepan-1-yl)-1,3-dimethyl-7-(3-oxobutan-2-yl)purine-2,6-dione |
| SMILES | CC(=O)C(C)n1c(N2CCCCCC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H25N5O3/c1-11(12(2)23)22-13-14(19(3)17(25)20(4)15(13)24)18-16(22)21-9-7-5-6-8-10-21/h11H,5-10H2,1-4H3 |
| InChIKey | IJSUYJRBHYBAEH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |