C20H23N5O3 — CID 1036712
1,3-dimethyl-7-phenacyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 1036712) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1,3-dimethyl-7-phenacyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-phenacyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 1036712 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1,3-dimethyl-7-phenacyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCCCC3)n2CC(=O)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C20H23N5O3/c1-22-17-16(18(27)23(2)20(22)28)25(13-15(26)14-9-5-3-6-10-14)19(21-17)24-11-7-4-8-12-24/h3,5-6,9-10H,4,7-8,11-13H2,1-2H3 |
| InChIKey | JKUIACWEVNFLDE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |