C19H20N6O6 — CID 1422312
1,3-dimethyl-8-morpholin-4-yl-7-[2-(3-nitrophenyl)-2-oxoethyl]purine-2,6-dione (PubChem CID 1422312) has the molecular formula C19H20N6O6 and a molecular weight of 428.41 g/mol. Its IUPAC name is 1,3-dimethyl-8-morpholin-4-yl-7-[2-(3-nitrophenyl)-2-oxoethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-morpholin-4-yl-7-[2-(3-nitrophenyl)-2-oxoethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 1422312 |
| Molecular Formula | C19H20N6O6 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1,3-dimethyl-8-morpholin-4-yl-7-[2-(3-nitrophenyl)-2-oxoethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCOCC3)n2CC(=O)c2cccc([N+](=O)[O-])c2)n(C)c1=O |
| InChI | InChI=1S/C19H20N6O6/c1-21-16-15(17(27)22(2)19(21)28)24(18(20-16)23-6-8-31-9-7-23)11-14(26)12-4-3-5-13(10-12)25(29)30/h3-5,10H,6-9,11H2,1-2H3 |
| InChIKey | GTKBDMUZTAREFV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 134.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|