C21H25ClN6O3 — CID 66953795
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione;hydrochloride (PubChem CID 66953795) has the molecular formula C21H25ClN6O3 and a molecular weight of 444.92 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione;hydrochloride.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 66953795 |
| Molecular Formula | C21H25ClN6O3 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(nc(N3CCC4CNCC43)n2CC(=O)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C21H24N6O3.ClH/c1-24-18-17(19(29)25(2)21(24)30)27(12-16(28)13-6-4-3-5-7-13)20(23-18)26-9-8-14-10-22-11-15(14)26;/h3-7,14-15,22H,8-12H2,1-2H3;1H |
| InChIKey | FFEBLBWBECVIKD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |