C24H27N7O4 — CID 66954357
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(1,3-oxazol-2-ylmethyl)-1-(2-phenoxyethyl)purine-2,6-dione (PubChem CID 66954357) has the molecular formula C24H27N7O4 and a molecular weight of 477.53 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(1,3-oxazol-2-ylmethyl)-1-(2-phenoxyethyl)purine-2,6-dione.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(1,3-oxazol-2-ylmethyl)-1-(2-phenoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66954357 |
| Molecular Formula | C24H27N7O4 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-7-(1,3-oxazol-2-ylmethyl)-1-(2-phenoxyethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCOc2ccccc2)c(=O)c2c1nc(N1CCC3CNCC31)n2Cc1ncco1 |
| InChI | InChI=1S/C24H27N7O4/c1-28-21-20(22(32)30(24(28)33)10-12-34-17-5-3-2-4-6-17)31(15-19-26-8-11-35-19)23(27-21)29-9-7-16-13-25-14-18(16)29/h2-6,8,11,16,18,25H,7,9-10,12-15H2,1H3 |
| InChIKey | BKTATCWQMWRNQB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |