C26H29IN6O3 — CID 10232398
8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-3-methyl-1-(2-phenoxyethyl)purine-2,6-dione (PubChem CID 10232398) has the molecular formula C26H29IN6O3 and a molecular weight of 600.46 g/mol. Its IUPAC name is 8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-3-methyl-1-(2-phenoxyethyl)purine-2,6-dione.
| Compound Name | 8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-3-methyl-1-(2-phenoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 10232398 |
| Molecular Formula | C26H29IN6O3 |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]-3-methyl-1-(2-phenoxyethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCOc2ccccc2)c(=O)c2c1nc(N1CCCNCC1)n2Cc1ccccc1I |
| InChI | InChI=1S/C26H29IN6O3/c1-30-23-22(24(34)32(26(30)35)16-17-36-20-9-3-2-4-10-20)33(18-19-8-5-6-11-21(19)27)25(29-23)31-14-7-12-28-13-15-31/h2-6,8-11,28H,7,12-18H2,1H3 |
| InChIKey | RYNSDHRRCXUHDS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|