C44H51IN12O4 — CID 158859780
3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]purine-2,6-dione;7-benzyl-3-methyl-8-piperazin-1-yl-1-propylpurine-2,6-dione (PubChem CID 158859780) has the molecular formula C44H51IN12O4 and a molecular weight of 938.88 g/mol. Its IUPAC name is 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]purine-2,6-dione;7-benzyl-3-methyl-8-piperazin-1-yl-1-propylpurine-2,6-dione.
| Compound Name | 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]purine-2,6-dione;7-benzyl-3-methyl-8-piperazin-1-yl-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 158859780 |
| Molecular Formula | C44H51IN12O4 |
| Molecular Weight | 938.88 g/mol |
| Exact Mass | 938.32 |
| IUPAC Name | 3-benzyl-8-(1,4-diazepan-1-yl)-7-[(2-iodophenyl)methyl]purine-2,6-dione;7-benzyl-3-methyl-8-piperazin-1-yl-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(N3CCNCC3)n2Cc2ccccc2)n(C)c1=O.O=c1[nH]c(=O)n(Cc2ccccc2)c2nc(N3CCCNCC3)n(Cc3ccccc3I)c12 |
| InChI | InChI=1S/C24H25IN6O2.C20H26N6O2/c25-19-10-5-4-9-18(19)16-30-20-21(27-23(30)29-13-6-11-26-12-14-29)31(24(33)28-22(20)32)15-17-7-2-1-3-8-17;1-3-11-25-18(27)16-17(23(2)20(25)28)22-19(24-12-9-21-10-13-24)26(16)14-15-7-5-4-6-8-15/h1-5,7-10,26H,6,11-16H2,(H,28,32,33);4-8,21H,3,9-14H2,1-2H3 |
| InChIKey | JAMYRGAPFZESGT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 165.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|