C24H23N7O2 — CID 10181799
2-[(3-benzyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzonitrile (PubChem CID 10181799) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 2-[(3-benzyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzonitrile.
| Compound Name | 2-[(3-benzyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 10181799 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[(3-benzyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1c(N2CCNCC2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H23N7O2/c25-14-18-8-4-5-9-19(18)16-30-20-21(27-23(30)29-12-10-26-11-13-29)31(24(33)28-22(20)32)15-17-6-2-1-3-7-17/h1-9,26H,10-13,15-16H2,(H,28,32,33) |
| InChIKey | FQNCNHMYMXLKJN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |