C24H26N6O2 — CID 10113521
3-benzyl-7-(2-phenylethyl)-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 10113521) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-benzyl-7-(2-phenylethyl)-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 3-benzyl-7-(2-phenylethyl)-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 10113521 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3-benzyl-7-(2-phenylethyl)-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c2nc(N3CCNCC3)n(CCc3ccccc3)c12 |
| InChI | InChI=1S/C24H26N6O2/c31-22-20-21(30(24(32)27-22)17-19-9-5-2-6-10-19)26-23(28-15-12-25-13-16-28)29(20)14-11-18-7-3-1-4-8-18/h1-10,25H,11-17H2,(H,27,31,32) |
| InChIKey | HVPCSXHMLGSQSS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |