C18H21N5O2 — CID 679995
7-benzyl-3-methyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 679995) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 7-benzyl-3-methyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-benzyl-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 679995 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 7-benzyl-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C18H21N5O2/c1-21-15-14(16(24)20-18(21)25)23(12-13-8-4-2-5-9-13)17(19-15)22-10-6-3-7-11-22/h2,4-5,8-9H,3,6-7,10-12H2,1H3,(H,20,24,25) |
| InChIKey | ROWQWDCJHZGBIX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |