C14H20ClN5O3 — CID 677803
7-[(2R)-3-chloro-2-hydroxypropyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 677803) has the molecular formula C14H20ClN5O3 and a molecular weight of 341.80 g/mol. Its IUPAC name is 7-[(2R)-3-chloro-2-hydroxypropyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-[(2R)-3-chloro-2-hydroxypropyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 677803 |
| Molecular Formula | C14H20ClN5O3 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 7-[(2R)-3-chloro-2-hydroxypropyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCC1)n2C[C@@H](O)CCl |
| InChI | InChI=1S/C14H20ClN5O3/c1-18-11-10(12(22)17-14(18)23)20(8-9(21)7-15)13(16-11)19-5-3-2-4-6-19/h9,21H,2-8H2,1H3,(H,17,22,23)/t9-/m0/s1 |
| InChIKey | SGMHHYJTZBBAMU-VIFPVBQESA-N |
| XLogP | 0.01 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|