C13H18ClN5O4 — CID 3117112
7-(3-chloro-2-hydroxypropyl)-3-methyl-8-morpholin-4-ylpurine-2,6-dione (PubChem CID 3117112) has the molecular formula C13H18ClN5O4 and a molecular weight of 343.77 g/mol. Its IUPAC name is 7-(3-chloro-2-hydroxypropyl)-3-methyl-8-morpholin-4-ylpurine-2,6-dione.
| Compound Name | 7-(3-chloro-2-hydroxypropyl)-3-methyl-8-morpholin-4-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 3117112 |
| Molecular Formula | C13H18ClN5O4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 7-(3-chloro-2-hydroxypropyl)-3-methyl-8-morpholin-4-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCOCC1)n2CC(O)CCl |
| InChI | InChI=1S/C13H18ClN5O4/c1-17-10-9(11(21)16-13(17)22)19(7-8(20)6-14)12(15-10)18-2-4-23-5-3-18/h8,20H,2-7H2,1H3,(H,16,21,22) |
| InChIKey | FJEQNVPWOCABKV-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|