C17H25N5O4 — CID 6491972
7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 6491972) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 6491972 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | C=CCOCC(O)Cn1c(N2CCCCC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H25N5O4/c1-3-9-26-11-12(23)10-22-13-14(20(2)17(25)19-15(13)24)18-16(22)21-7-5-4-6-8-21/h3,12,23H,1,4-11H2,2H3,(H,19,24,25) |
| InChIKey | HJAXAQOULAVSCV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|