C14H21N5O4 — CID 6484522
8-(ethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methylpurine-2,6-dione (PubChem CID 6484522) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 8-(ethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-(ethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 6484522 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 8-(ethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methylpurine-2,6-dione |
| SMILES | C=CCOCC(O)Cn1c(NCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H21N5O4/c1-4-6-23-8-9(20)7-19-10-11(16-13(19)15-5-2)18(3)14(22)17-12(10)21/h4,9,20H,1,5-8H2,2-3H3,(H,15,16)(H,17,21,22) |
| InChIKey | FGIOFFJCMLSHPY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|