C13H19BrN4O4 — CID 3103840
8-bromo-7-(3-butoxy-2-hydroxypropyl)-3-methylpurine-2,6-dione (PubChem CID 3103840) has the molecular formula C13H19BrN4O4 and a molecular weight of 375.22 g/mol. Its IUPAC name is 8-bromo-7-(3-butoxy-2-hydroxypropyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-bromo-7-(3-butoxy-2-hydroxypropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3103840 |
| Molecular Formula | C13H19BrN4O4 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 8-bromo-7-(3-butoxy-2-hydroxypropyl)-3-methylpurine-2,6-dione |
| SMILES | CCCCOCC(O)Cn1c(Br)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C13H19BrN4O4/c1-3-4-5-22-7-8(19)6-18-9-10(15-12(18)14)17(2)13(21)16-11(9)20/h8,19H,3-7H2,1-2H3,(H,16,20,21) |
| InChIKey | NFNYCIRXSFCBEW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|