C16H16Br2N8O4 — CID 3736328
8-bromo-7-[4-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)butyl]-3-methylpurine-2,6-dione (PubChem CID 3736328) has the molecular formula C16H16Br2N8O4 and a molecular weight of 544.16 g/mol. Its IUPAC name is 8-bromo-7-[4-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)butyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-bromo-7-[4-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)butyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3736328 |
| Molecular Formula | C16H16Br2N8O4 |
| Molecular Weight | 544.16 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 8-bromo-7-[4-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)butyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Br)n2CCCCn1c(Br)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H16Br2N8O4/c1-23-9-7(11(27)21-15(23)29)25(13(17)19-9)5-3-4-6-26-8-10(20-14(26)18)24(2)16(30)22-12(8)28/h3-6H2,1-2H3,(H,21,27,29)(H,22,28,30) |
| InChIKey | KBEKWUKANFLMPS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|