C20H25BrN8O4S — CID 3113208
8-[3-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)propylsulfanyl]-3-methyl-7-pentylpurine-2,6-dione (PubChem CID 3113208) has the molecular formula C20H25BrN8O4S and a molecular weight of 553.44 g/mol. Its IUPAC name is 8-[3-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)propylsulfanyl]-3-methyl-7-pentylpurine-2,6-dione.
| Compound Name | 8-[3-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)propylsulfanyl]-3-methyl-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 3113208 |
| Molecular Formula | C20H25BrN8O4S |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 8-[3-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)propylsulfanyl]-3-methyl-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(SCCCn2c(Br)nc3c2c(=O)[nH]c(=O)n3C)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C20H25BrN8O4S/c1-4-5-6-8-29-12-14(27(3)19(33)25-16(12)31)23-20(29)34-10-7-9-28-11-13(22-17(28)21)26(2)18(32)24-15(11)30/h4-10H2,1-3H3,(H,24,30,32)(H,25,31,33) |
| InChIKey | VREPZMKGEOVWGE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|