C12H16N4O4S — CID 4314624
2-(7-butyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid (PubChem CID 4314624) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(7-butyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid.
| Compound Name | 2-(7-butyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 4314624 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(7-butyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid |
| SMILES | CCCCn1c(SCC(=O)O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C12H16N4O4S/c1-3-4-5-16-8-9(13-12(16)21-6-7(17)18)15(2)11(20)14-10(8)19/h3-6H2,1-2H3,(H,17,18)(H,14,19,20) |
| InChIKey | OHMFAHMIYSFGPO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |