C23H40N4O2S — CID 3120013
7-decyl-8-heptylsulfanyl-3-methylpurine-2,6-dione (PubChem CID 3120013) has the molecular formula C23H40N4O2S and a molecular weight of 436.67 g/mol. Its IUPAC name is 7-decyl-8-heptylsulfanyl-3-methylpurine-2,6-dione.
| Compound Name | 7-decyl-8-heptylsulfanyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3120013 |
| Molecular Formula | C23H40N4O2S |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 7-decyl-8-heptylsulfanyl-3-methylpurine-2,6-dione |
| SMILES | CCCCCCCCCCn1c(SCCCCCCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C23H40N4O2S/c1-4-6-8-10-11-12-13-15-17-27-19-20(26(3)22(29)25-21(19)28)24-23(27)30-18-16-14-9-7-5-2/h4-18H2,1-3H3,(H,25,28,29) |
| InChIKey | JXQPPCVBOZTTGA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|