C18H29N5O3S — CID 2857487
2-(7-decyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetamide (PubChem CID 2857487) has the molecular formula C18H29N5O3S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(7-decyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetamide.
| Compound Name | 2-(7-decyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2857487 |
| Molecular Formula | C18H29N5O3S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(7-decyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetamide |
| SMILES | CCCCCCCCCCn1c(SCC(N)=O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C18H29N5O3S/c1-3-4-5-6-7-8-9-10-11-23-14-15(20-18(23)27-12-13(19)24)22(2)17(26)21-16(14)25/h3-12H2,1-2H3,(H2,19,24)(H,21,25,26) |
| InChIKey | PWURXABIMYXANS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|