C24H42N4O2S — CID 3120014
7-decyl-3-methyl-8-octylsulfanylpurine-2,6-dione (PubChem CID 3120014) has the molecular formula C24H42N4O2S and a molecular weight of 450.69 g/mol. Its IUPAC name is 7-decyl-3-methyl-8-octylsulfanylpurine-2,6-dione.
| Compound Name | 7-decyl-3-methyl-8-octylsulfanylpurine-2,6-dione |
|---|---|
| PubChem CID | 3120014 |
| Molecular Formula | C24H42N4O2S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 7-decyl-3-methyl-8-octylsulfanylpurine-2,6-dione |
| SMILES | CCCCCCCCCCn1c(SCCCCCCCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C24H42N4O2S/c1-4-6-8-10-12-13-14-16-18-28-20-21(27(3)23(30)26-22(20)29)25-24(28)31-19-17-15-11-9-7-5-2/h4-19H2,1-3H3,(H,26,29,30) |
| InChIKey | WBCNTIDUOFALIS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|