C11H15BrN4O2S — CID 4296096
8-(2-bromoethylsulfanyl)-3-methyl-7-propylpurine-2,6-dione (PubChem CID 4296096) has the molecular formula C11H15BrN4O2S and a molecular weight of 347.24 g/mol. Its IUPAC name is 8-(2-bromoethylsulfanyl)-3-methyl-7-propylpurine-2,6-dione.
| Compound Name | 8-(2-bromoethylsulfanyl)-3-methyl-7-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 4296096 |
| Molecular Formula | C11H15BrN4O2S |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 8-(2-bromoethylsulfanyl)-3-methyl-7-propylpurine-2,6-dione |
| SMILES | CCCn1c(SCCBr)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C11H15BrN4O2S/c1-3-5-16-7-8(13-11(16)19-6-4-12)15(2)10(18)14-9(7)17/h3-6H2,1-2H3,(H,14,17,18) |
| InChIKey | VIXVJBPLVXRQKZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|