C14H20N4O4S — CID 630967
ethyl 3-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylpropanoate (PubChem CID 630967) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is ethyl 3-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylpropanoate.
| Compound Name | ethyl 3-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 630967 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | ethyl 3-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylpropanoate |
| SMILES | CCCn1c(SCCC(=O)OCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H20N4O4S/c1-4-7-18-10-11(17(3)13(21)16-12(10)20)15-14(18)23-8-6-9(19)22-5-2/h4-8H2,1-3H3,(H,16,20,21) |
| InChIKey | HAYITYVJAHSLDT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |