C15H22N4O4S — CID 1004882
ethyl (2R)-2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylbutanoate (PubChem CID 1004882) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is ethyl (2R)-2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylbutanoate.
| Compound Name | ethyl (2R)-2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylbutanoate |
|---|---|
| PubChem CID | 1004882 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | ethyl (2R)-2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylbutanoate |
| SMILES | CCCn1c(S[C@H](CC)C(=O)OCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H22N4O4S/c1-5-8-19-10-11(18(4)14(22)17-12(10)20)16-15(19)24-9(6-2)13(21)23-7-3/h9H,5-8H2,1-4H3,(H,17,20,22)/t9-/m1/s1 |
| InChIKey | FSTFZEJKDZPPHG-SECBINFHSA-N |
| XLogP | 1.27 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |