C15H22N4O4S — CID 3111705
ethyl 2-(3-methyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanylbutanoate (PubChem CID 3111705) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is ethyl 2-(3-methyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanylbutanoate.
| Compound Name | ethyl 2-(3-methyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanylbutanoate |
|---|---|
| PubChem CID | 3111705 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | ethyl 2-(3-methyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanylbutanoate |
| SMILES | CCOC(=O)C(CC)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1C(C)C |
| InChI | InChI=1S/C15H22N4O4S/c1-6-9(13(21)23-7-2)24-15-16-11-10(19(15)8(3)4)12(20)17-14(22)18(11)5/h8-9H,6-7H2,1-5H3,(H,17,20,22) |
| InChIKey | RAZAGUMHUUJWII-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |