C13H18N4O4S — CID 741843
ethyl 2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylacetate (PubChem CID 741843) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is ethyl 2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylacetate.
| Compound Name | ethyl 2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylacetate |
|---|---|
| PubChem CID | 741843 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl 2-(3-methyl-2,6-dioxo-7-propylpurin-8-yl)sulfanylacetate |
| SMILES | CCCn1c(SCC(=O)OCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C13H18N4O4S/c1-4-6-17-9-10(16(3)12(20)15-11(9)19)14-13(17)22-7-8(18)21-5-2/h4-7H2,1-3H3,(H,15,19,20) |
| InChIKey | XOSMFAIVHKAWGI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |