C11H14N4O4S — CID 27370828
methyl 2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetate (PubChem CID 27370828) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is methyl 2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetate.
| Compound Name | methyl 2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetate |
|---|---|
| PubChem CID | 27370828 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | methyl 2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetate |
| SMILES | CCn1c(SCC(=O)OC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C11H14N4O4S/c1-4-15-7-8(14(2)10(18)13-9(7)17)12-11(15)20-5-6(16)19-3/h4-5H2,1-3H3,(H,13,17,18) |
| InChIKey | OSXSDWBOBOTEMV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |