C16H25N5O4S — CID 131665677
cyclohexanamine;2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid (PubChem CID 131665677) has the molecular formula C16H25N5O4S and a molecular weight of 383.47 g/mol. Its IUPAC name is cyclohexanamine;2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid.
| Compound Name | cyclohexanamine;2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 131665677 |
| Molecular Formula | C16H25N5O4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | cyclohexanamine;2-(7-ethyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylacetic acid |
| SMILES | CCn1c(SCC(=O)O)nc2c1c(=O)[nH]c(=O)n2C.NC1CCCCC1 |
| InChI | InChI=1S/C10H12N4O4S.C6H13N/c1-3-14-6-7(11-10(14)19-4-5(15)16)13(2)9(18)12-8(6)17;7-6-4-2-1-3-5-6/h3-4H2,1-2H3,(H,15,16)(H,12,17,18);6H,1-5,7H2 |
| InChIKey | UVNAQGNPLNZDMX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |