C11H16N4O2S — CID 677004
7-ethyl-3-methyl-8-propan-2-ylsulfanylpurine-2,6-dione (PubChem CID 677004) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 7-ethyl-3-methyl-8-propan-2-ylsulfanylpurine-2,6-dione.
| Compound Name | 7-ethyl-3-methyl-8-propan-2-ylsulfanylpurine-2,6-dione |
|---|---|
| PubChem CID | 677004 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 7-ethyl-3-methyl-8-propan-2-ylsulfanylpurine-2,6-dione |
| SMILES | CCn1c(SC(C)C)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C11H16N4O2S/c1-5-15-7-8(12-11(15)18-6(2)3)14(4)10(17)13-9(7)16/h6H,5H2,1-4H3,(H,13,16,17) |
| InChIKey | ROGAFFXKZCRIBW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |