C11H14BrClN4O2 — CID 3097609
8-bromo-7-(5-chloropentyl)-3-methylpurine-2,6-dione (PubChem CID 3097609) has the molecular formula C11H14BrClN4O2 and a molecular weight of 349.62 g/mol. Its IUPAC name is 8-bromo-7-(5-chloropentyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-bromo-7-(5-chloropentyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3097609 |
| Molecular Formula | C11H14BrClN4O2 |
| Molecular Weight | 349.62 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 8-bromo-7-(5-chloropentyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Br)n2CCCCCCl |
| InChI | InChI=1S/C11H14BrClN4O2/c1-16-8-7(9(18)15-11(16)19)17(10(12)14-8)6-4-2-3-5-13/h2-6H2,1H3,(H,15,18,19) |
| InChIKey | YFALWFZAVDYRMG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|