C13H17BrN4O4 — CID 3093805
pentyl 2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 3093805) has the molecular formula C13H17BrN4O4 and a molecular weight of 373.21 g/mol. Its IUPAC name is pentyl 2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | pentyl 2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 3093805 |
| Molecular Formula | C13H17BrN4O4 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | pentyl 2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | CCCCCOC(=O)Cn1c(Br)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C13H17BrN4O4/c1-3-4-5-6-22-8(19)7-18-9-10(15-12(18)14)17(2)13(21)16-11(9)20/h3-7H2,1-2H3,(H,16,20,21) |
| InChIKey | SSRBZBFHRFMPRW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|