C14H14BrClN4O2 — CID 130445632
8-bromo-7-[(2E,4E)-5-chloro-2-ethenylhexa-2,4-dienyl]-3-methylpurine-2,6-dione (PubChem CID 130445632) has the molecular formula C14H14BrClN4O2 and a molecular weight of 385.65 g/mol. Its IUPAC name is 8-bromo-7-[(2E,4E)-5-chloro-2-ethenylhexa-2,4-dienyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-bromo-7-[(2E,4E)-5-chloro-2-ethenylhexa-2,4-dienyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 130445632 |
| Molecular Formula | C14H14BrClN4O2 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 8-bromo-7-[(2E,4E)-5-chloro-2-ethenylhexa-2,4-dienyl]-3-methylpurine-2,6-dione |
| SMILES | C=C/C(=C\C=C(/C)Cl)Cn1c(Br)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H14BrClN4O2/c1-4-9(6-5-8(2)16)7-20-10-11(17-13(20)15)19(3)14(22)18-12(10)21/h4-6H,1,7H2,2-3H3,(H,18,21,22)/b8-5+,9-6+ |
| InChIKey | AQJHBALIYIGJNX-XVYDYJIPSA-N |
| XLogP | 2.44 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|