C10H13N5O2 — CID 776805
8-amino-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione (PubChem CID 776805) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 8-amino-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione.
| Compound Name | 8-amino-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 776805 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 8-amino-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione |
| SMILES | C=C(C)Cn1c(N)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C10H13N5O2/c1-5(2)4-15-6-7(12-9(15)11)14(3)10(17)13-8(6)16/h1,4H2,2-3H3,(H2,11,12)(H,13,16,17) |
| InChIKey | HATYSZAHWWDGDB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|