C10H12N4O2S — CID 776773
3-methyl-7-(2-methylprop-2-enyl)-8-sulfanylidene-9H-purine-2,6-dione (PubChem CID 776773) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 3-methyl-7-(2-methylprop-2-enyl)-8-sulfanylidene-9H-purine-2,6-dione.
| Compound Name | 3-methyl-7-(2-methylprop-2-enyl)-8-sulfanylidene-9H-purine-2,6-dione |
|---|---|
| PubChem CID | 776773 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-methyl-7-(2-methylprop-2-enyl)-8-sulfanylidene-9H-purine-2,6-dione |
| SMILES | C=C(C)Cn1c(=S)[nH]c2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C10H12N4O2S/c1-5(2)4-14-6-7(11-10(14)17)13(3)9(16)12-8(6)15/h1,4H2,2-3H3,(H,11,17)(H,12,15,16) |
| InChIKey | DZKYZRQISKBGDM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|