C15H14Cl2N4O4S — CID 3107929
7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-3-methyl-8-sulfanylidene-9H-purine-2,6-dione (PubChem CID 3107929) has the molecular formula C15H14Cl2N4O4S and a molecular weight of 417.27 g/mol. Its IUPAC name is 7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-3-methyl-8-sulfanylidene-9H-purine-2,6-dione.
| Compound Name | 7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-3-methyl-8-sulfanylidene-9H-purine-2,6-dione |
|---|---|
| PubChem CID | 3107929 |
| Molecular Formula | C15H14Cl2N4O4S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-3-methyl-8-sulfanylidene-9H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1[nH]c(=S)n2CC(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N4O4S/c1-20-12-11(13(23)19-14(20)24)21(15(26)18-12)5-8(22)6-25-10-3-2-7(16)4-9(10)17/h2-4,8,22H,5-6H2,1H3,(H,18,26)(H,19,23,24) |
| InChIKey | LZLCBDONPUCBGN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|