C14H12Cl2N4O3 — CID 47073068
8-[(2,4-dichlorophenoxy)methyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 47073068) has the molecular formula C14H12Cl2N4O3 and a molecular weight of 355.18 g/mol. Its IUPAC name is 8-[(2,4-dichlorophenoxy)methyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[(2,4-dichlorophenoxy)methyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 47073068 |
| Molecular Formula | C14H12Cl2N4O3 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 8-[(2,4-dichlorophenoxy)methyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(COc2ccc(Cl)cc2Cl)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H12Cl2N4O3/c1-19-10(6-23-9-4-3-7(15)5-8(9)16)17-12-11(19)13(21)18-14(22)20(12)2/h3-5H,6H2,1-2H3,(H,18,21,22) |
| InChIKey | NVASQJPZOXEFQT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |