C21H17ClN4O3 — CID 67650216
8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 67650216) has the molecular formula C21H17ClN4O3 and a molecular weight of 408.85 g/mol. Its IUPAC name is 8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 67650216 |
| Molecular Formula | C21H17ClN4O3 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(Cc2ccc(C(=O)c3ccc(Cl)cc3)cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C21H17ClN4O3/c1-25-16(23-19-17(25)20(28)24-21(29)26(19)2)11-12-3-5-13(6-4-12)18(27)14-7-9-15(22)10-8-14/h3-10H,11H2,1-2H3,(H,24,28,29) |
| InChIKey | YFOCOSPCKVEHDZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |