C21H27ClN4O2S — CID 3113194
8-[(4-chlorophenyl)methylsulfanyl]-3-methyl-7-octylpurine-2,6-dione (PubChem CID 3113194) has the molecular formula C21H27ClN4O2S and a molecular weight of 434.99 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)methylsulfanyl]-3-methyl-7-octylpurine-2,6-dione.
| Compound Name | 8-[(4-chlorophenyl)methylsulfanyl]-3-methyl-7-octylpurine-2,6-dione |
|---|---|
| PubChem CID | 3113194 |
| Molecular Formula | C21H27ClN4O2S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 8-[(4-chlorophenyl)methylsulfanyl]-3-methyl-7-octylpurine-2,6-dione |
| SMILES | CCCCCCCCn1c(SCc2ccc(Cl)cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C21H27ClN4O2S/c1-3-4-5-6-7-8-13-26-17-18(25(2)20(28)24-19(17)27)23-21(26)29-14-15-9-11-16(22)12-10-15/h9-12H,3-8,13-14H2,1-2H3,(H,24,27,28) |
| InChIKey | OYFAZHAGBVYIGK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|