C19H22ClFN4O2S — CID 16626950
8-[(2-chloro-6-fluorophenyl)methylsulfanyl]-7-hexyl-3-methylpurine-2,6-dione (PubChem CID 16626950) has the molecular formula C19H22ClFN4O2S and a molecular weight of 424.93 g/mol. Its IUPAC name is 8-[(2-chloro-6-fluorophenyl)methylsulfanyl]-7-hexyl-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2-chloro-6-fluorophenyl)methylsulfanyl]-7-hexyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 16626950 |
| Molecular Formula | C19H22ClFN4O2S |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 8-[(2-chloro-6-fluorophenyl)methylsulfanyl]-7-hexyl-3-methylpurine-2,6-dione |
| SMILES | CCCCCCn1c(SCc2c(F)cccc2Cl)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C19H22ClFN4O2S/c1-3-4-5-6-10-25-15-16(24(2)18(27)23-17(15)26)22-19(25)28-11-12-13(20)8-7-9-14(12)21/h7-9H,3-6,10-11H2,1-2H3,(H,23,26,27) |
| InChIKey | MVNZLHIOBDIHKT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|