C23H31ClN6O2 — CID 3107482
8-[2-[1-(4-chlorophenyl)ethylidene]hydrazinyl]-3-methyl-7-nonylpurine-2,6-dione (PubChem CID 3107482) has the molecular formula C23H31ClN6O2 and a molecular weight of 458.99 g/mol. Its IUPAC name is 8-[2-[1-(4-chlorophenyl)ethylidene]hydrazinyl]-3-methyl-7-nonylpurine-2,6-dione.
| Compound Name | 8-[2-[1-(4-chlorophenyl)ethylidene]hydrazinyl]-3-methyl-7-nonylpurine-2,6-dione |
|---|---|
| PubChem CID | 3107482 |
| Molecular Formula | C23H31ClN6O2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 8-[2-[1-(4-chlorophenyl)ethylidene]hydrazinyl]-3-methyl-7-nonylpurine-2,6-dione |
| SMILES | CCCCCCCCCn1c(NN=C(C)c2ccc(Cl)cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C23H31ClN6O2/c1-4-5-6-7-8-9-10-15-30-19-20(29(3)23(32)26-21(19)31)25-22(30)28-27-16(2)17-11-13-18(24)14-12-17/h11-14H,4-10,15H2,1-3H3,(H,25,28)(H,26,31,32) |
| InChIKey | DAEWISSLPNGONV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|