C17H20N6O4 — CID 3123520
8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-7-(2-methoxyethyl)-3-methylpurine-2,6-dione (PubChem CID 3123520) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is 8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-7-(2-methoxyethyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-7-(2-methoxyethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3123520 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-7-(2-methoxyethyl)-3-methylpurine-2,6-dione |
| SMILES | COCCn1c(NN=C(C)c2ccc(O)cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H20N6O4/c1-10(11-4-6-12(24)7-5-11)20-21-16-18-14-13(23(16)8-9-27-3)15(25)19-17(26)22(14)2/h4-7,24H,8-9H2,1-3H3,(H,18,21)(H,19,25,26) |
| InChIKey | IJBIQUYJTJPJPZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|