C9H14N6O3 — CID 3123512
8-hydrazinyl-7-(2-methoxyethyl)-3-methylpurine-2,6-dione (PubChem CID 3123512) has the molecular formula C9H14N6O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 8-hydrazinyl-7-(2-methoxyethyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-hydrazinyl-7-(2-methoxyethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3123512 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 8-hydrazinyl-7-(2-methoxyethyl)-3-methylpurine-2,6-dione |
| SMILES | COCCn1c(NN)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C9H14N6O3/c1-14-6-5(7(16)12-9(14)17)15(3-4-18-2)8(11-6)13-10/h3-4,10H2,1-2H3,(H,11,13)(H,12,16,17) |
| InChIKey | NYBZATNWTLVHLF-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|