C9H12N6O2 — CID 823143
8-hydrazinyl-3-methyl-7-prop-2-enylpurine-2,6-dione (PubChem CID 823143) has the molecular formula C9H12N6O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 8-hydrazinyl-3-methyl-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 8-hydrazinyl-3-methyl-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 823143 |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 8-hydrazinyl-3-methyl-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(NN)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C9H12N6O2/c1-3-4-15-5-6(11-8(15)13-10)14(2)9(17)12-7(5)16/h3H,1,4,10H2,2H3,(H,11,13)(H,12,16,17) |
| InChIKey | QKWUSELXJUMWCU-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|